C25H21F3N4O5 — CID 27088277
4-[2-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethylamino]-3-nitro-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 27088277) has the molecular formula C25H21F3N4O5 and a molecular weight of 514.46 g/mol. Its IUPAC name is 4-[2-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethylamino]-3-nitro-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-[2-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethylamino]-3-nitro-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 27088277 |
| Molecular Formula | C25H21F3N4O5 |
| Molecular Weight | 514.46 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 4-[2-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethylamino]-3-nitro-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1ccc(NCCN2C(=O)[C@@H]3[C@@H](C2=O)[C@H]2C=C[C@@H]3C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H21F3N4O5/c26-25(27,28)16-2-1-3-17(12-16)30-22(33)15-6-7-18(19(11-15)32(36)37)29-8-9-31-23(34)20-13-4-5-14(10-13)21(20)24(31)35/h1-7,11-14,20-21,29H,8-10H2,(H,30,33)/t13-,14+,20-,21-/m0/s1 |
| InChIKey | ZOPULRBHQREEAY-ZVLVQXPOSA-N |
| XLogP | 4.08 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|