C12H11N3OS2 — CID 27089074
(NZ)-N-[(1R)-1-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-dihydroinden-2-ylidene]hydroxylamine (PubChem CID 27089074) has the molecular formula C12H11N3OS2 and a molecular weight of 277.37 g/mol. Its IUPAC name is (NZ)-N-[(1R)-1-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-dihydroinden-2-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(1R)-1-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-dihydroinden-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 27089074 |
| Molecular Formula | C12H11N3OS2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | (NZ)-N-[(1R)-1-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-dihydroinden-2-ylidene]hydroxylamine |
| SMILES | Cc1nnc(S[C@H]2/C(=N\O)Cc3ccccc32)s1 |
| InChI | InChI=1S/C12H11N3OS2/c1-7-13-14-12(17-7)18-11-9-5-3-2-4-8(9)6-10(11)15-16/h2-5,11,16H,6H2,1H3/b15-10-/t11-/m1/s1 |
| InChIKey | OSTHXOIZQRBQSE-MKVLZVNKSA-N |
| XLogP | 3.07 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|