C14H3F6NO2 — CID 27101385
2-(3,5-difluorophenyl)-4,5,6,7-tetrafluoroisoindole-1,3-dione (PubChem CID 27101385) has the molecular formula C14H3F6NO2 and a molecular weight of 331.17 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-4,5,6,7-tetrafluoroisoindole-1,3-dione.
| Compound Name | 2-(3,5-difluorophenyl)-4,5,6,7-tetrafluoroisoindole-1,3-dione |
|---|---|
| PubChem CID | 27101385 |
| Molecular Formula | C14H3F6NO2 |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 2-(3,5-difluorophenyl)-4,5,6,7-tetrafluoroisoindole-1,3-dione |
| SMILES | O=C1c2c(F)c(F)c(F)c(F)c2C(=O)N1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H3F6NO2/c15-4-1-5(16)3-6(2-4)21-13(22)7-8(14(21)23)10(18)12(20)11(19)9(7)17/h1-3H |
| InChIKey | CDTZEIMEHRQQQW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|