About 3-phenacyl-1,3-diazaspiro[4.6]undecane-2,4-dione
3-phenacyl-1,3-diazaspiro[4.6]undecane-2,4-dione (PubChem CID 2710901) has the molecular formula C17H20N2O3
and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-phenacyl-1,3-diazaspiro[4.6]undecane-2,4-dione.
Molecular Properties
| Compound Name | 3-phenacyl-1,3-diazaspiro[4.6]undecane-2,4-dione |
| PubChem CID | 2710901 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 3-phenacyl-1,3-diazaspiro[4.6]undecane-2,4-dione |
| SMILES | O=C(CN1C(=O)NC2(CCCCCC2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O3/c20-14(13-8-4-3-5-9-13)12-19-15(21)17(18-16(19)22)10-6-1-2-7-11-17/h3-5,8-9H,1-2,6-7,10-12H2,(H,18,22) |
| InChIKey | QZVMUCWFDPWEFA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 3-phenacyl-1,3-diazaspiro[4.6]undecane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenacyl-1,3-diazaspiro[4.6]undecane-2,4-dione?
The IUPAC name of 3-phenacyl-1,3-diazaspiro[4.6]undecane-2,4-dione (CID 2710901) is 3-phenacyl-1,3-diazaspiro[4.6]undecane-2,4-dione.
What is the SMILES notation for 3-phenacyl-1,3-diazaspiro[4.6]undecane-2,4-dione?
The canonical SMILES for 3-phenacyl-1,3-diazaspiro[4.6]undecane-2,4-dione is O=C(CN1C(=O)NC2(CCCCCC2)C1=O)c1ccccc1.
What is the InChIKey of 3-phenacyl-1,3-diazaspiro[4.6]undecane-2,4-dione?
The InChIKey is QZVMUCWFDPWEFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O3/c20-14(13-8-4-3-5-9-13)12-19-15(21)17(18-16(19)22)10-6-1-2-7-11-17/h3-5,8-9H,1-2,6-7,10-12H2,(H,18,22).
What are the key properties of 3-phenacyl-1,3-diazaspiro[4.6]undecane-2,4-dione?
3-phenacyl-1,3-diazaspiro[4.6]undecane-2,4-dione has a molecular weight of 300.36 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenacyl-1,3-diazaspiro[4.6]undecane-2,4-dione is sourced from PubChem (CID 2710901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).