C17H16N2O2 — CID 2711808
2-(4-cyanophenoxy)-N-[(1S)-1-phenylethyl]acetamide (PubChem CID 2711808) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-[(1S)-1-phenylethyl]acetamide.
| Compound Name | 2-(4-cyanophenoxy)-N-[(1S)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 2711808 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-[(1S)-1-phenylethyl]acetamide |
| SMILES | C[C@H](NC(=O)COc1ccc(C#N)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H16N2O2/c1-13(15-5-3-2-4-6-15)19-17(20)12-21-16-9-7-14(11-18)8-10-16/h2-10,13H,12H2,1H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | LZKGCWBCORYPAD-ZDUSSCGKSA-N |
| XLogP | 2.81 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |