C13H18F6N2O — CID 2712530
1-[2-(cyclohexen-1-yl)ethyl]-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)urea (PubChem CID 2712530) has the molecular formula C13H18F6N2O and a molecular weight of 332.29 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)urea.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)urea |
|---|---|
| PubChem CID | 2712530 |
| Molecular Formula | C13H18F6N2O |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)urea |
| SMILES | CC(NC(=O)NCCC1=CCCCC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H18F6N2O/c1-11(12(14,15)16,13(17,18)19)21-10(22)20-8-7-9-5-3-2-4-6-9/h5H,2-4,6-8H2,1H3,(H2,20,21,22) |
| InChIKey | SRHUBBOHZZPAIW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|