C15H19Cl2NO — CID 2712577
N-cycloheptyl-2-(2,4-dichlorophenyl)acetamide (PubChem CID 2712577) has the molecular formula C15H19Cl2NO and a molecular weight of 300.23 g/mol. Its IUPAC name is N-cycloheptyl-2-(2,4-dichlorophenyl)acetamide.
| Compound Name | N-cycloheptyl-2-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 2712577 |
| Molecular Formula | C15H19Cl2NO |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-cycloheptyl-2-(2,4-dichlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)NC1CCCCCC1 |
| InChI | InChI=1S/C15H19Cl2NO/c16-12-8-7-11(14(17)10-12)9-15(19)18-13-5-3-1-2-4-6-13/h7-8,10,13H,1-6,9H2,(H,18,19) |
| InChIKey | BLWIPGHFZSFBJT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |