C14H19NOS — CID 27126630
[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-thiophen-2-ylmethanone (PubChem CID 27126630) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 27126630 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C14H19NOS/c16-14(13-8-4-10-17-13)15-9-3-6-11-5-1-2-7-12(11)15/h4,8,10-12H,1-3,5-7,9H2/t11-,12-/m0/s1 |
| InChIKey | UDRRRGUFYOFPGU-RYUDHWBXSA-N |
| XLogP | 3.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |