C15H17N3O6S3 — CID 27126896
(3R)-3-[2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-5-nitrobenzimidazol-1-yl]thiolane 1,1-dioxide (PubChem CID 27126896) has the molecular formula C15H17N3O6S3 and a molecular weight of 431.52 g/mol. Its IUPAC name is (3R)-3-[2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-5-nitrobenzimidazol-1-yl]thiolane 1,1-dioxide.
| Compound Name | (3R)-3-[2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-5-nitrobenzimidazol-1-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 27126896 |
| Molecular Formula | C15H17N3O6S3 |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | (3R)-3-[2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-5-nitrobenzimidazol-1-yl]thiolane 1,1-dioxide |
| SMILES | O=[N+]([O-])c1ccc2c(c1)nc(S[C@H]1CCS(=O)(=O)C1)n2[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H17N3O6S3/c19-18(20)10-1-2-14-13(7-10)16-15(25-12-4-6-27(23,24)9-12)17(14)11-3-5-26(21,22)8-11/h1-2,7,11-12H,3-6,8-9H2/t11-,12+/m1/s1 |
| InChIKey | OQLUXNIVAGDCHF-NEPJUHHUSA-N |
| XLogP | 1.58 |
| TPSA | 129.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|