C10H21N3O4S — CID 27129107
N-(2-methoxyethyl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide (PubChem CID 27129107) has the molecular formula C10H21N3O4S and a molecular weight of 279.36 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide.
| Compound Name | N-(2-methoxyethyl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 27129107 |
| Molecular Formula | C10H21N3O4S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N-(2-methoxyethyl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide |
| SMILES | COCCNC(=O)CN1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C10H21N3O4S/c1-17-8-3-11-10(14)9-12-4-6-13(7-5-12)18(2,15)16/h3-9H2,1-2H3,(H,11,14) |
| InChIKey | QZDKPANIEQUIDP-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|