C16H19IN2O4 — CID 27136407
ethyl (4S)-4-(2-ethoxy-5-iodophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 27136407) has the molecular formula C16H19IN2O4 and a molecular weight of 430.24 g/mol. Its IUPAC name is ethyl (4S)-4-(2-ethoxy-5-iodophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-4-(2-ethoxy-5-iodophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 27136407 |
| Molecular Formula | C16H19IN2O4 |
| Molecular Weight | 430.24 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | ethyl (4S)-4-(2-ethoxy-5-iodophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=O)N[C@H]1c1cc(I)ccc1OCC |
| InChI | InChI=1S/C16H19IN2O4/c1-4-22-12-7-6-10(17)8-11(12)14-13(15(20)23-5-2)9(3)18-16(21)19-14/h6-8,14H,4-5H2,1-3H3,(H2,18,19,21)/t14-/m0/s1 |
| InChIKey | TWGFEPGHBCPNEU-AWEZNQCLSA-N |
| XLogP | 2.88 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|