C19H22ClNO2 — CID 27137747
N-[[4-[(2-chlorophenyl)methoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine (PubChem CID 27137747) has the molecular formula C19H22ClNO2 and a molecular weight of 331.84 g/mol. Its IUPAC name is N-[[4-[(2-chlorophenyl)methoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine.
| Compound Name | N-[[4-[(2-chlorophenyl)methoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine |
|---|---|
| PubChem CID | 27137747 |
| Molecular Formula | C19H22ClNO2 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-[[4-[(2-chlorophenyl)methoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine |
| SMILES | Clc1ccccc1COc1ccc(CNC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C19H22ClNO2/c20-19-6-2-1-4-16(19)14-23-17-9-7-15(8-10-17)12-21-13-18-5-3-11-22-18/h1-2,4,6-10,18,21H,3,5,11-14H2/t18-/m1/s1 |
| InChIKey | JOZYBTUUABYQNK-GOSISDBHSA-N |
| XLogP | 4.19 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |