C18H29N3OS — CID 27140282
(2R)-N-(cyclohexylmethyl)-2-(6-methyl-2-propan-2-ylpyrimidin-4-yl)sulfanylpropanamide (PubChem CID 27140282) has the molecular formula C18H29N3OS and a molecular weight of 335.52 g/mol. Its IUPAC name is (2R)-N-(cyclohexylmethyl)-2-(6-methyl-2-propan-2-ylpyrimidin-4-yl)sulfanylpropanamide.
| Compound Name | (2R)-N-(cyclohexylmethyl)-2-(6-methyl-2-propan-2-ylpyrimidin-4-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 27140282 |
| Molecular Formula | C18H29N3OS |
| Molecular Weight | 335.52 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | (2R)-N-(cyclohexylmethyl)-2-(6-methyl-2-propan-2-ylpyrimidin-4-yl)sulfanylpropanamide |
| SMILES | Cc1cc(S[C@H](C)C(=O)NCC2CCCCC2)nc(C(C)C)n1 |
| InChI | InChI=1S/C18H29N3OS/c1-12(2)17-20-13(3)10-16(21-17)23-14(4)18(22)19-11-15-8-6-5-7-9-15/h10,12,14-15H,5-9,11H2,1-4H3,(H,19,22)/t14-/m1/s1 |
| InChIKey | RWZXOSHVJNVBQS-CQSZACIVSA-N |
| XLogP | 4.09 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |