C26H27N3O4 — CID 27153042
3-(4,7-dimethyl-2-oxochromen-3-yl)-N-[(R)-(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]propanamide (PubChem CID 27153042) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 3-(4,7-dimethyl-2-oxochromen-3-yl)-N-[(R)-(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]propanamide.
| Compound Name | 3-(4,7-dimethyl-2-oxochromen-3-yl)-N-[(R)-(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 27153042 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 3-(4,7-dimethyl-2-oxochromen-3-yl)-N-[(R)-(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]propanamide |
| SMILES | COc1ccc([C@@H](NC(=O)CCc2c(C)c3ccc(C)cc3oc2=O)c2nccn2C)cc1 |
| InChI | InChI=1S/C26H27N3O4/c1-16-5-10-20-17(2)21(26(31)33-22(20)15-16)11-12-23(30)28-24(25-27-13-14-29(25)3)18-6-8-19(32-4)9-7-18/h5-10,13-15,24H,11-12H2,1-4H3,(H,28,30)/t24-/m1/s1 |
| InChIKey | IQEDPWASUCASGV-XMMPIXPASA-N |
| XLogP | 3.99 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|