C27H19NO2S — CID 27153773
(5R)-3,3',3'-triphenylspiro[1,4,2-dioxazole-5,1'-2-benzothiophene] (PubChem CID 27153773) has the molecular formula C27H19NO2S and a molecular weight of 421.52 g/mol. Its IUPAC name is (5R)-3,3',3'-triphenylspiro[1,4,2-dioxazole-5,1'-2-benzothiophene].
| Compound Name | (5R)-3,3',3'-triphenylspiro[1,4,2-dioxazole-5,1'-2-benzothiophene] |
|---|---|
| PubChem CID | 27153773 |
| Molecular Formula | C27H19NO2S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | (5R)-3,3',3'-triphenylspiro[1,4,2-dioxazole-5,1'-2-benzothiophene] |
| SMILES | c1ccc(C2=NO[C@@]3(O2)SC(c2ccccc2)(c2ccccc2)c2ccccc23)cc1 |
| InChI | InChI=1S/C27H19NO2S/c1-4-12-20(13-5-1)25-28-30-27(29-25)24-19-11-10-18-23(24)26(31-27,21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1-19H/t27-/m1/s1 |
| InChIKey | JLWWHWKRXSSGHU-HHHXNRCGSA-N |
| XLogP | 6.24 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |