C19H16N2S — CID 27153802
(2R,5R)-4,5-diphenyl-2-thiophen-2-yl-2,5-dihydro-1H-imidazole (PubChem CID 27153802) has the molecular formula C19H16N2S and a molecular weight of 304.42 g/mol. Its IUPAC name is (2R,5R)-4,5-diphenyl-2-thiophen-2-yl-2,5-dihydro-1H-imidazole.
| Compound Name | (2R,5R)-4,5-diphenyl-2-thiophen-2-yl-2,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 27153802 |
| Molecular Formula | C19H16N2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (2R,5R)-4,5-diphenyl-2-thiophen-2-yl-2,5-dihydro-1H-imidazole |
| SMILES | c1ccc(C2=N[C@H](c3cccs3)N[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16N2S/c1-3-8-14(9-4-1)17-18(15-10-5-2-6-11-15)21-19(20-17)16-12-7-13-22-16/h1-13,17,19-20H/t17-,19-/m1/s1 |
| InChIKey | QLWSFZWQNFVVEC-IEBWSBKVSA-N |
| XLogP | 4.58 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |