C17H18N2O3 — CID 27157902
N-[2-(2-hydroxyanilino)-2-oxoethyl]-3,4-dimethylbenzamide (PubChem CID 27157902) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is N-[2-(2-hydroxyanilino)-2-oxoethyl]-3,4-dimethylbenzamide.
| Compound Name | N-[2-(2-hydroxyanilino)-2-oxoethyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 27157902 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-[2-(2-hydroxyanilino)-2-oxoethyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)Nc2ccccc2O)cc1C |
| InChI | InChI=1S/C17H18N2O3/c1-11-7-8-13(9-12(11)2)17(22)18-10-16(21)19-14-5-3-4-6-15(14)20/h3-9,20H,10H2,1-2H3,(H,18,22)(H,19,21) |
| InChIKey | JLDINOJRRQXOCJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|