C19H20N4O2S — CID 27167963
2-(4-benzyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-N-(4-ethoxyphenyl)acetamide (PubChem CID 27167963) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-(4-benzyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-(4-benzyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 27167963 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-(4-benzyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)Cc2n[nH]c(=S)n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C19H20N4O2S/c1-2-25-16-10-8-15(9-11-16)20-18(24)12-17-21-22-19(26)23(17)13-14-6-4-3-5-7-14/h3-11H,2,12-13H2,1H3,(H,20,24)(H,22,26) |
| InChIKey | OIUKENRASOQLHI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|