C22H27N5O5S — CID 27170440
2-methyl-N'-[3-(1-methyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)propanoyl]furan-3-carbohydrazide (PubChem CID 27170440) has the molecular formula C22H27N5O5S and a molecular weight of 473.56 g/mol. Its IUPAC name is 2-methyl-N'-[3-(1-methyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)propanoyl]furan-3-carbohydrazide.
| Compound Name | 2-methyl-N'-[3-(1-methyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)propanoyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 27170440 |
| Molecular Formula | C22H27N5O5S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 2-methyl-N'-[3-(1-methyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)propanoyl]furan-3-carbohydrazide |
| SMILES | Cc1occc1C(=O)NNC(=O)CCc1nc2cc(S(=O)(=O)N3CCCCC3)ccc2n1C |
| InChI | InChI=1S/C22H27N5O5S/c1-15-17(10-13-32-15)22(29)25-24-21(28)9-8-20-23-18-14-16(6-7-19(18)26(20)2)33(30,31)27-11-4-3-5-12-27/h6-7,10,13-14H,3-5,8-9,11-12H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | UKLSQFLXYGABGE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|