C25H17F4N3S — CID 2717186
4-(4-methylphenyl)-2-[3-naphthalen-2-yl-5-(1,1,2,2-tetrafluoroethyl)pyrazol-1-yl]-1,3-thiazole (PubChem CID 2717186) has the molecular formula C25H17F4N3S and a molecular weight of 467.49 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2-[3-naphthalen-2-yl-5-(1,1,2,2-tetrafluoroethyl)pyrazol-1-yl]-1,3-thiazole.
| Compound Name | 4-(4-methylphenyl)-2-[3-naphthalen-2-yl-5-(1,1,2,2-tetrafluoroethyl)pyrazol-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 2717186 |
| Molecular Formula | C25H17F4N3S |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 4-(4-methylphenyl)-2-[3-naphthalen-2-yl-5-(1,1,2,2-tetrafluoroethyl)pyrazol-1-yl]-1,3-thiazole |
| SMILES | Cc1ccc(-c2csc(-n3nc(-c4ccc5ccccc5c4)cc3C(F)(F)C(F)F)n2)cc1 |
| InChI | InChI=1S/C25H17F4N3S/c1-15-6-8-17(9-7-15)21-14-33-24(30-21)32-22(25(28,29)23(26)27)13-20(31-32)19-11-10-16-4-2-3-5-18(16)12-19/h2-14,23H,1H3 |
| InChIKey | ODQDZJQLMBEFCO-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|