C21H16ClNO4 — CID 2717862
2-[4-[(E)-[5-(4-chlorophenyl)-2-oxofuran-3-ylidene]methyl]-2-ethoxyphenoxy]acetonitrile (PubChem CID 2717862) has the molecular formula C21H16ClNO4 and a molecular weight of 381.82 g/mol. Its IUPAC name is 2-[4-[(E)-[5-(4-chlorophenyl)-2-oxofuran-3-ylidene]methyl]-2-ethoxyphenoxy]acetonitrile.
| Compound Name | 2-[4-[(E)-[5-(4-chlorophenyl)-2-oxofuran-3-ylidene]methyl]-2-ethoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 2717862 |
| Molecular Formula | C21H16ClNO4 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 2-[4-[(E)-[5-(4-chlorophenyl)-2-oxofuran-3-ylidene]methyl]-2-ethoxyphenoxy]acetonitrile |
| SMILES | CCOc1cc(/C=C2\C=C(c3ccc(Cl)cc3)OC2=O)ccc1OCC#N |
| InChI | InChI=1S/C21H16ClNO4/c1-2-25-20-12-14(3-8-18(20)26-10-9-23)11-16-13-19(27-21(16)24)15-4-6-17(22)7-5-15/h3-8,11-13H,2,10H2,1H3/b16-11+ |
| InChIKey | OPNILPCXBWQVLR-LFIBNONCSA-N |
| XLogP | 4.62 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|