C20H22N2O7 — CID 27189410
[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl 2,4,5-trimethylfuran-3-carboxylate (PubChem CID 27189410) has the molecular formula C20H22N2O7 and a molecular weight of 402.40 g/mol. Its IUPAC name is [5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl 2,4,5-trimethylfuran-3-carboxylate.
| Compound Name | [5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl 2,4,5-trimethylfuran-3-carboxylate |
|---|---|
| PubChem CID | 27189410 |
| Molecular Formula | C20H22N2O7 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | [5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl 2,4,5-trimethylfuran-3-carboxylate |
| SMILES | COc1cc(-c2nnc(COC(=O)c3c(C)oc(C)c3C)o2)cc(OC)c1OC |
| InChI | InChI=1S/C20H22N2O7/c1-10-11(2)28-12(3)17(10)20(23)27-9-16-21-22-19(29-16)13-7-14(24-4)18(26-6)15(8-13)25-5/h7-8H,9H2,1-6H3 |
| InChIKey | XZXIXCBKUIDLPQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 106.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |