C16H25NO3 — CID 27194648
methyl 2-[[(3R,5S)-3,5-dimethyladamantane-1-carbonyl]amino]acetate (PubChem CID 27194648) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is methyl 2-[[(3R,5S)-3,5-dimethyladamantane-1-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[(3R,5S)-3,5-dimethyladamantane-1-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 27194648 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | methyl 2-[[(3R,5S)-3,5-dimethyladamantane-1-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)C12CC3C[C@@](C)(C1)C[C@](C)(C3)C2 |
| InChI | InChI=1S/C16H25NO3/c1-14-4-11-5-15(2,8-14)10-16(6-11,9-14)13(19)17-7-12(18)20-3/h11H,4-10H2,1-3H3,(H,17,19)/t11?,14-,15+,16? |
| InChIKey | LJPSKXXMZOKEBM-ZDELEMRZSA-N |
| XLogP | 2.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |