About 2-iodo-N-phenylbenzamide
2-iodo-N-phenylbenzamide (PubChem CID 27195) has the molecular formula C13H10INO
and a molecular weight of 323.13 g/mol. Its IUPAC name is 2-iodo-N-phenylbenzamide.
Molecular Properties
| Compound Name | 2-iodo-N-phenylbenzamide |
| PubChem CID | 27195 |
| Molecular Formula | C13H10INO |
| Molecular Weight | 323.13 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 2-iodo-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccccc1I |
| InChI | InChI=1S/C13H10INO/c14-12-9-5-4-8-11(12)13(16)15-10-6-2-1-3-7-10/h1-9H,(H,15,16) |
| InChIKey | LJOZMWRYMKECFF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.13 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-N-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-N-phenylbenzamide?
The IUPAC name of 2-iodo-N-phenylbenzamide (CID 27195) is 2-iodo-N-phenylbenzamide.
What is the SMILES notation for 2-iodo-N-phenylbenzamide?
The canonical SMILES for 2-iodo-N-phenylbenzamide is O=C(Nc1ccccc1)c1ccccc1I.
What is the InChIKey of 2-iodo-N-phenylbenzamide?
The InChIKey is LJOZMWRYMKECFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10INO/c14-12-9-5-4-8-11(12)13(16)15-10-6-2-1-3-7-10/h1-9H,(H,15,16).
What are the key properties of 2-iodo-N-phenylbenzamide?
2-iodo-N-phenylbenzamide has a molecular weight of 323.13 g/mol, XLogP of 3.54, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-N-phenylbenzamide is sourced from PubChem (CID 27195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).