C22H21Cl2NO4S — CID 2719714
(5Z)-5-[[4-[(2R)-butan-2-yl]oxy-3-methoxyphenyl]methylidene]-3-[(2,6-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 2719714) has the molecular formula C22H21Cl2NO4S and a molecular weight of 466.39 g/mol. Its IUPAC name is (5Z)-5-[[4-[(2R)-butan-2-yl]oxy-3-methoxyphenyl]methylidene]-3-[(2,6-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[(2R)-butan-2-yl]oxy-3-methoxyphenyl]methylidene]-3-[(2,6-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2719714 |
| Molecular Formula | C22H21Cl2NO4S |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | (5Z)-5-[[4-[(2R)-butan-2-yl]oxy-3-methoxyphenyl]methylidene]-3-[(2,6-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC[C@@H](C)Oc1ccc(/C=C2\SC(=O)N(Cc3c(Cl)cccc3Cl)C2=O)cc1OC |
| InChI | InChI=1S/C22H21Cl2NO4S/c1-4-13(2)29-18-9-8-14(10-19(18)28-3)11-20-21(26)25(22(27)30-20)12-15-16(23)6-5-7-17(15)24/h5-11,13H,4,12H2,1-3H3/b20-11-/t13-/m1/s1 |
| InChIKey | NFRIWKOEVFLQQL-RBFBNPFJSA-N |
| XLogP | 6.42 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|