C24H19ClFNO3S — CID 2719986
(5Z)-3-[(2-chloro-6-fluorophenyl)methyl]-5-[(2-propoxynaphthalen-1-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 2719986) has the molecular formula C24H19ClFNO3S and a molecular weight of 455.94 g/mol. Its IUPAC name is (5Z)-3-[(2-chloro-6-fluorophenyl)methyl]-5-[(2-propoxynaphthalen-1-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[(2-chloro-6-fluorophenyl)methyl]-5-[(2-propoxynaphthalen-1-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2719986 |
| Molecular Formula | C24H19ClFNO3S |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | (5Z)-3-[(2-chloro-6-fluorophenyl)methyl]-5-[(2-propoxynaphthalen-1-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCOc1ccc2ccccc2c1/C=C1\SC(=O)N(Cc2c(F)cccc2Cl)C1=O |
| InChI | InChI=1S/C24H19ClFNO3S/c1-2-12-30-21-11-10-15-6-3-4-7-16(15)17(21)13-22-23(28)27(24(29)31-22)14-18-19(25)8-5-9-20(18)26/h3-11,13H,2,12,14H2,1H3/b22-13- |
| InChIKey | IJXLYOFEXFRDKB-XKZIYDEJSA-N |
| XLogP | 6.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|