C19H21N3O2 — CID 27205425
(2S)-N-(3-cyanophenyl)-2-[(2-methoxyphenyl)methyl-methylamino]propanamide (PubChem CID 27205425) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is (2S)-N-(3-cyanophenyl)-2-[(2-methoxyphenyl)methyl-methylamino]propanamide.
| Compound Name | (2S)-N-(3-cyanophenyl)-2-[(2-methoxyphenyl)methyl-methylamino]propanamide |
|---|---|
| PubChem CID | 27205425 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (2S)-N-(3-cyanophenyl)-2-[(2-methoxyphenyl)methyl-methylamino]propanamide |
| SMILES | COc1ccccc1CN(C)[C@@H](C)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C19H21N3O2/c1-14(19(23)21-17-9-6-7-15(11-17)12-20)22(2)13-16-8-4-5-10-18(16)24-3/h4-11,14H,13H2,1-3H3,(H,21,23)/t14-/m0/s1 |
| InChIKey | MWEGJTCUANUAPP-AWEZNQCLSA-N |
| XLogP | 3.03 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |