C27H29N3O3 — CID 2721454
4-methyl-N-[(E)-3-(2-morpholin-4-ylethylamino)-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 2721454) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 4-methyl-N-[(E)-3-(2-morpholin-4-ylethylamino)-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 4-methyl-N-[(E)-3-(2-morpholin-4-ylethylamino)-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 2721454 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 4-methyl-N-[(E)-3-(2-morpholin-4-ylethylamino)-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(C(=O)N/C(=C/c2cccc3ccccc23)C(=O)NCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C27H29N3O3/c1-20-9-11-22(12-10-20)26(31)29-25(27(32)28-13-14-30-15-17-33-18-16-30)19-23-7-4-6-21-5-2-3-8-24(21)23/h2-12,19H,13-18H2,1H3,(H,28,32)(H,29,31)/b25-19+ |
| InChIKey | VTNCAOVPQITLFG-NCELDCMTSA-N |
| XLogP | 3.37 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|