C16H17N3O4S2 — CID 2721858
(1S,9S)-8,16-bis(methylsulfonyl)-8,16,17-triazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene (PubChem CID 2721858) has the molecular formula C16H17N3O4S2 and a molecular weight of 379.46 g/mol. Its IUPAC name is (1S,9S)-8,16-bis(methylsulfonyl)-8,16,17-triazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene.
| Compound Name | (1S,9S)-8,16-bis(methylsulfonyl)-8,16,17-triazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene |
|---|---|
| PubChem CID | 2721858 |
| Molecular Formula | C16H17N3O4S2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | (1S,9S)-8,16-bis(methylsulfonyl)-8,16,17-triazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene |
| SMILES | CS(=O)(=O)N1c2ccccc2[C@H]2N[C@@H]1c1ccccc1N2S(C)(=O)=O |
| InChI | InChI=1S/C16H17N3O4S2/c1-24(20,21)18-13-9-5-3-7-11(13)16-17-15(18)12-8-4-6-10-14(12)19(16)25(2,22)23/h3-10,15-17H,1-2H3/t15-,16-/m0/s1 |
| InChIKey | ROMXICIZQIJIER-HOTGVXAUSA-N |
| XLogP | 1.53 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |