C25H26ClN3O2 — CID 27220919
(2S)-N-benzhydryl-2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]propanamide (PubChem CID 27220919) has the molecular formula C25H26ClN3O2 and a molecular weight of 435.96 g/mol. Its IUPAC name is (2S)-N-benzhydryl-2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]propanamide.
| Compound Name | (2S)-N-benzhydryl-2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]propanamide |
|---|---|
| PubChem CID | 27220919 |
| Molecular Formula | C25H26ClN3O2 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | (2S)-N-benzhydryl-2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]propanamide |
| SMILES | C[C@@H](C(=O)NC(c1ccccc1)c1ccccc1)N(C)CC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C25H26ClN3O2/c1-18(29(2)17-23(30)27-22-16-10-9-15-21(22)26)25(31)28-24(19-11-5-3-6-12-19)20-13-7-4-8-14-20/h3-16,18,24H,17H2,1-2H3,(H,27,30)(H,28,31)/t18-/m0/s1 |
| InChIKey | WZPAVKHNWJDGIP-SFHVURJKSA-N |
| XLogP | 4.50 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |