C21H26N4O5 — CID 27221763
N-(4-methoxy-2-nitrophenyl)-2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]acetamide (PubChem CID 27221763) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is N-(4-methoxy-2-nitrophenyl)-2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]acetamide.
| Compound Name | N-(4-methoxy-2-nitrophenyl)-2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]acetamide |
|---|---|
| PubChem CID | 27221763 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N-(4-methoxy-2-nitrophenyl)-2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]acetamide |
| SMILES | CCCN(CC(=O)Nc1ccccc1C)CC(=O)Nc1ccc(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H26N4O5/c1-4-11-24(13-20(26)22-17-8-6-5-7-15(17)2)14-21(27)23-18-10-9-16(30-3)12-19(18)25(28)29/h5-10,12H,4,11,13-14H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | XDSFDRXTQGYVSQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|