C25H18N2O4S — CID 2722506
methyl (10aR)-2,3-dioxo-1,4-diphenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-10a-carboxylate (PubChem CID 2722506) has the molecular formula C25H18N2O4S and a molecular weight of 442.50 g/mol. Its IUPAC name is methyl (10aR)-2,3-dioxo-1,4-diphenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-10a-carboxylate.
| Compound Name | methyl (10aR)-2,3-dioxo-1,4-diphenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-10a-carboxylate |
|---|---|
| PubChem CID | 2722506 |
| Molecular Formula | C25H18N2O4S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | methyl (10aR)-2,3-dioxo-1,4-diphenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-10a-carboxylate |
| SMILES | COC(=O)[C@]12Sc3ccccc3NC(c3ccccc3)=C1C(=O)C(=O)N2c1ccccc1 |
| InChI | InChI=1S/C25H18N2O4S/c1-31-24(30)25-20(22(28)23(29)27(25)17-12-6-3-7-13-17)21(16-10-4-2-5-11-16)26-18-14-8-9-15-19(18)32-25/h2-15,26H,1H3/t25-/m1/s1 |
| InChIKey | QZUYIJVMYNAESD-RUZDIDTESA-N |
| XLogP | 4.10 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|