C18H25NO5S — CID 27228
methanesulfonate;[3-methoxy-4-(4-phenylbutoxy)phenyl]azanium (PubChem CID 27228) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is methanesulfonate;[3-methoxy-4-(4-phenylbutoxy)phenyl]azanium.
| Compound Name | methanesulfonate;[3-methoxy-4-(4-phenylbutoxy)phenyl]azanium |
|---|---|
| PubChem CID | 27228 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | methanesulfonate;[3-methoxy-4-(4-phenylbutoxy)phenyl]azanium |
| SMILES | COc1cc([NH3+])ccc1OCCCCc1ccccc1.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C17H21NO2.CH4O3S/c1-19-17-13-15(18)10-11-16(17)20-12-6-5-9-14-7-3-2-4-8-14;1-5(2,3)4/h2-4,7-8,10-11,13H,5-6,9,12,18H2,1H3;1H3,(H,2,3,4) |
| InChIKey | PDZNTVLICZQYHO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|