C31H33N3O3 — CID 27235526
(5R)-2,2-dimethyl-5-[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one (PubChem CID 27235526) has the molecular formula C31H33N3O3 and a molecular weight of 495.62 g/mol. Its IUPAC name is (5R)-2,2-dimethyl-5-[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one.
| Compound Name | (5R)-2,2-dimethyl-5-[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one |
|---|---|
| PubChem CID | 27235526 |
| Molecular Formula | C31H33N3O3 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | (5R)-2,2-dimethyl-5-[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one |
| SMILES | CC1CCN(c2ccc([N+](=O)[O-])cc2[C@H]2Nc3ccc4ccccc4c3C3=C2C(=O)CC(C)(C)C3)CC1 |
| InChI | InChI=1S/C31H33N3O3/c1-19-12-14-33(15-13-19)26-11-9-21(34(36)37)16-23(26)30-29-24(17-31(2,3)18-27(29)35)28-22-7-5-4-6-20(22)8-10-25(28)32-30/h4-11,16,19,30,32H,12-15,17-18H2,1-3H3/t30-/m1/s1 |
| InChIKey | NSICSGPCLHMDTC-SSEXGKCCSA-N |
| XLogP | 7.29 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|