About 2-hydroxy-5-sulfobenzoic acid;dihydrate
2-hydroxy-5-sulfobenzoic acid;dihydrate (PubChem CID 2723734) has the molecular formula C7H10O8S
and a molecular weight of 254.22 g/mol. Its IUPAC name is 2-hydroxy-5-sulfobenzoic acid;dihydrate.
Molecular Properties
| Compound Name | 2-hydroxy-5-sulfobenzoic acid;dihydrate |
| PubChem CID | 2723734 |
| Molecular Formula | C7H10O8S |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 2-hydroxy-5-sulfobenzoic acid;dihydrate |
| SMILES | O.O.O=C(O)c1cc(S(=O)(=O)O)ccc1O |
| InChI | InChI=1S/C7H6O6S.2H2O/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;;/h1-3,8H,(H,9,10)(H,11,12,13);2*1H2 |
| InChIKey | BHDKTFQBRFWJKR-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 174.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-5-sulfobenzoic acid;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-5-sulfobenzoic acid;dihydrate?
The IUPAC name of 2-hydroxy-5-sulfobenzoic acid;dihydrate (CID 2723734) is 2-hydroxy-5-sulfobenzoic acid;dihydrate.
What is the SMILES notation for 2-hydroxy-5-sulfobenzoic acid;dihydrate?
The canonical SMILES for 2-hydroxy-5-sulfobenzoic acid;dihydrate is O.O.O=C(O)c1cc(S(=O)(=O)O)ccc1O.
What is the InChIKey of 2-hydroxy-5-sulfobenzoic acid;dihydrate?
The InChIKey is BHDKTFQBRFWJKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O6S.2H2O/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;;/h1-3,8H,(H,9,10)(H,11,12,13);2*1H2.
What are the key properties of 2-hydroxy-5-sulfobenzoic acid;dihydrate?
2-hydroxy-5-sulfobenzoic acid;dihydrate has a molecular weight of 254.22 g/mol, XLogP of -1.31, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-5-sulfobenzoic acid;dihydrate is sourced from PubChem (CID 2723734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).