C4H10O — CID 2723765
1,1,1,2,2-pentadeuterio-2-(1,1,2,2,2-pentadeuterioethoxy)ethane (PubChem CID 2723765) has the molecular formula C4H10O and a molecular weight of 84.18 g/mol. Its IUPAC name is 1,1,1,2,2-pentadeuterio-2-(1,1,2,2,2-pentadeuterioethoxy)ethane.
| Compound Name | 1,1,1,2,2-pentadeuterio-2-(1,1,2,2,2-pentadeuterioethoxy)ethane |
|---|---|
| PubChem CID | 2723765 |
| Molecular Formula | C4H10O |
| Molecular Weight | 84.18 g/mol |
| Exact Mass | 84.14 |
| IUPAC Name | 1,1,1,2,2-pentadeuterio-2-(1,1,2,2,2-pentadeuterioethoxy)ethane |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C4H10O/c1-3-5-4-2/h3-4H2,1-2H3/i1D3,2D3,3D2,4D2 |
| InChIKey | RTZKZFJDLAIYFH-MWUKXHIBSA-N |
| XLogP | 1.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 84.18 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |