About 2,9-dimethyl-1,10-phenanthroline;hydrate;hydrochloride
2,9-dimethyl-1,10-phenanthroline;hydrate;hydrochloride (PubChem CID 2723838) has the molecular formula C14H15ClN2O
and a molecular weight of 262.74 g/mol. Its IUPAC name is 2,9-dimethyl-1,10-phenanthroline;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 2,9-dimethyl-1,10-phenanthroline;hydrate;hydrochloride |
| PubChem CID | 2723838 |
| Molecular Formula | C14H15ClN2O |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2,9-dimethyl-1,10-phenanthroline;hydrate;hydrochloride |
| SMILES | Cc1ccc2ccc3ccc(C)nc3c2n1.Cl.O |
| InChI | InChI=1S/C14H12N2.ClH.H2O/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;;/h3-8H,1-2H3;1H;1H2 |
| InChIKey | APDYLFLZNGECIM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 57.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2,9-dimethyl-1,10-phenanthroline;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,9-dimethyl-1,10-phenanthroline;hydrate;hydrochloride?
The IUPAC name of 2,9-dimethyl-1,10-phenanthroline;hydrate;hydrochloride (CID 2723838) is 2,9-dimethyl-1,10-phenanthroline;hydrate;hydrochloride.
What is the SMILES notation for 2,9-dimethyl-1,10-phenanthroline;hydrate;hydrochloride?
The canonical SMILES for 2,9-dimethyl-1,10-phenanthroline;hydrate;hydrochloride is Cc1ccc2ccc3ccc(C)nc3c2n1.Cl.O.
What is the InChIKey of 2,9-dimethyl-1,10-phenanthroline;hydrate;hydrochloride?
The InChIKey is APDYLFLZNGECIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2.ClH.H2O/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;;/h3-8H,1-2H3;1H;1H2.
What are the key properties of 2,9-dimethyl-1,10-phenanthroline;hydrate;hydrochloride?
2,9-dimethyl-1,10-phenanthroline;hydrate;hydrochloride has a molecular weight of 262.74 g/mol, XLogP of 3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-dimethyl-1,10-phenanthroline;hydrate;hydrochloride is sourced from PubChem (CID 2723838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).