About 5-bromo-1,3-thiazol-2-amine;hydrobromide
5-bromo-1,3-thiazol-2-amine;hydrobromide (PubChem CID 2723848) has the molecular formula C3H4Br2N2S
and a molecular weight of 259.95 g/mol. Its IUPAC name is 5-bromo-1,3-thiazol-2-amine;hydrobromide.
Molecular Properties
| Compound Name | 5-bromo-1,3-thiazol-2-amine;hydrobromide |
| PubChem CID | 2723848 |
| Molecular Formula | C3H4Br2N2S |
| Molecular Weight | 259.95 g/mol |
| Exact Mass | 257.85 |
| IUPAC Name | 5-bromo-1,3-thiazol-2-amine;hydrobromide |
| SMILES | Br.Nc1ncc(Br)s1 |
| InChI | InChI=1S/C3H3BrN2S.BrH/c4-2-1-6-3(5)7-2;/h1H,(H2,5,6);1H |
| InChIKey | NUSVDASTCPBUIP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.95 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-1,3-thiazol-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1,3-thiazol-2-amine;hydrobromide?
The IUPAC name of 5-bromo-1,3-thiazol-2-amine;hydrobromide (CID 2723848) is 5-bromo-1,3-thiazol-2-amine;hydrobromide.
What is the SMILES notation for 5-bromo-1,3-thiazol-2-amine;hydrobromide?
The canonical SMILES for 5-bromo-1,3-thiazol-2-amine;hydrobromide is Br.Nc1ncc(Br)s1.
What is the InChIKey of 5-bromo-1,3-thiazol-2-amine;hydrobromide?
The InChIKey is NUSVDASTCPBUIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3BrN2S.BrH/c4-2-1-6-3(5)7-2;/h1H,(H2,5,6);1H.
What are the key properties of 5-bromo-1,3-thiazol-2-amine;hydrobromide?
5-bromo-1,3-thiazol-2-amine;hydrobromide has a molecular weight of 259.95 g/mol, XLogP of 2.07, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1,3-thiazol-2-amine;hydrobromide is sourced from PubChem (CID 2723848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).