About (2R)-2-aminobutan-1-ol
(2R)-2-aminobutan-1-ol (PubChem CID 2723856) has the molecular formula C4H11NO
and a molecular weight of 89.14 g/mol. Its IUPAC name is (2R)-2-aminobutan-1-ol.
Molecular Properties
| Compound Name | (2R)-2-aminobutan-1-ol |
| PubChem CID | 2723856 |
| Molecular Formula | C4H11NO |
| Molecular Weight | 89.14 g/mol |
| Exact Mass | 89.08 |
| IUPAC Name | (2R)-2-aminobutan-1-ol |
| SMILES | CC[C@@H](N)CO |
| InChI | InChI=1S/C4H11NO/c1-2-4(5)3-6/h4,6H,2-3,5H2,1H3/t4-/m1/s1 |
| InChIKey | JCBPETKZIGVZRE-SCSAIBSYSA-N |
| XLogP | -0.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.14 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-aminobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-aminobutan-1-ol?
The IUPAC name of (2R)-2-aminobutan-1-ol (CID 2723856) is (2R)-2-aminobutan-1-ol.
What is the SMILES notation for (2R)-2-aminobutan-1-ol?
The canonical SMILES for (2R)-2-aminobutan-1-ol is CC[C@@H](N)CO.
What is the InChIKey of (2R)-2-aminobutan-1-ol?
The InChIKey is JCBPETKZIGVZRE-SCSAIBSYSA-N. The full InChI is InChI=1S/C4H11NO/c1-2-4(5)3-6/h4,6H,2-3,5H2,1H3/t4-/m1/s1.
What are the key properties of (2R)-2-aminobutan-1-ol?
(2R)-2-aminobutan-1-ol has a molecular weight of 89.14 g/mol, XLogP of -0.28, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-aminobutan-1-ol is sourced from PubChem (CID 2723856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).