About 2-[3,4-bis(phenylmethoxy)phenyl]ethanamine;hydrochloride
2-[3,4-bis(phenylmethoxy)phenyl]ethanamine;hydrochloride (PubChem CID 2723941) has the molecular formula C22H24ClNO2
and a molecular weight of 369.89 g/mol. Its IUPAC name is 2-[3,4-bis(phenylmethoxy)phenyl]ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-[3,4-bis(phenylmethoxy)phenyl]ethanamine;hydrochloride |
| PubChem CID | 2723941 |
| Molecular Formula | C22H24ClNO2 |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-[3,4-bis(phenylmethoxy)phenyl]ethanamine;hydrochloride |
| SMILES | Cl.NCCc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C22H23NO2.ClH/c23-14-13-18-11-12-21(24-16-19-7-3-1-4-8-19)22(15-18)25-17-20-9-5-2-6-10-20;/h1-12,15H,13-14,16-17,23H2;1H |
| InChIKey | KXIZXPRLNNDQKS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3,4-bis(phenylmethoxy)phenyl]ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,4-bis(phenylmethoxy)phenyl]ethanamine;hydrochloride?
The IUPAC name of 2-[3,4-bis(phenylmethoxy)phenyl]ethanamine;hydrochloride (CID 2723941) is 2-[3,4-bis(phenylmethoxy)phenyl]ethanamine;hydrochloride.
What is the SMILES notation for 2-[3,4-bis(phenylmethoxy)phenyl]ethanamine;hydrochloride?
The canonical SMILES for 2-[3,4-bis(phenylmethoxy)phenyl]ethanamine;hydrochloride is Cl.NCCc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1.
What is the InChIKey of 2-[3,4-bis(phenylmethoxy)phenyl]ethanamine;hydrochloride?
The InChIKey is KXIZXPRLNNDQKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO2.ClH/c23-14-13-18-11-12-21(24-16-19-7-3-1-4-8-19)22(15-18)25-17-20-9-5-2-6-10-20;/h1-12,15H,13-14,16-17,23H2;1H.
What are the key properties of 2-[3,4-bis(phenylmethoxy)phenyl]ethanamine;hydrochloride?
2-[3,4-bis(phenylmethoxy)phenyl]ethanamine;hydrochloride has a molecular weight of 369.89 g/mol, XLogP of 4.77, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,4-bis(phenylmethoxy)phenyl]ethanamine;hydrochloride is sourced from PubChem (CID 2723941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).