C6H5Br — CID 2723968
1-bromo-2,3,4,5,6-pentadeuteriobenzene (PubChem CID 2723968) has the molecular formula C6H5Br and a molecular weight of 162.04 g/mol. Its IUPAC name is 1-bromo-2,3,4,5,6-pentadeuteriobenzene.
| Compound Name | 1-bromo-2,3,4,5,6-pentadeuteriobenzene |
|---|---|
| PubChem CID | 2723968 |
| Molecular Formula | C6H5Br |
| Molecular Weight | 162.04 g/mol |
| Exact Mass | 160.99 |
| IUPAC Name | 1-bromo-2,3,4,5,6-pentadeuteriobenzene |
| SMILES | [2H]c1c([2H])c([2H])c(Br)c([2H])c1[2H] |
| InChI | InChI=1S/C6H5Br/c7-6-4-2-1-3-5-6/h1-5H/i1D,2D,3D,4D,5D |
| InChIKey | QARVLSVVCXYDNA-RALIUCGRSA-N |
| XLogP | 2.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.04 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |