C6H12O — CID 2723969
1,1,2,2,3,3,4,4,5,5,6-undecadeuterio-6-deuteriooxycyclohexane (PubChem CID 2723969) has the molecular formula C6H12O and a molecular weight of 112.23 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6-undecadeuterio-6-deuteriooxycyclohexane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6-undecadeuterio-6-deuteriooxycyclohexane |
|---|---|
| PubChem CID | 2723969 |
| Molecular Formula | C6H12O |
| Molecular Weight | 112.23 g/mol |
| Exact Mass | 112.16 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6-undecadeuterio-6-deuteriooxycyclohexane |
| SMILES | [2H]OC1([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C6H12O/c7-6-4-2-1-3-5-6/h6-7H,1-5H2/i1D2,2D2,3D2,4D2,5D2,6D,7D |
| InChIKey | HPXRVTGHNJAIIH-BFHGLDALSA-N |
| XLogP | 1.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |