C3H8O — CID 2723972
1,1,1,2,3,3,3-heptadeuterio-2-deuteriooxypropane (PubChem CID 2723972) has the molecular formula C3H8O and a molecular weight of 68.14 g/mol. Its IUPAC name is 1,1,1,2,3,3,3-heptadeuterio-2-deuteriooxypropane.
| Compound Name | 1,1,1,2,3,3,3-heptadeuterio-2-deuteriooxypropane |
|---|---|
| PubChem CID | 2723972 |
| Molecular Formula | C3H8O |
| Molecular Weight | 68.14 g/mol |
| Exact Mass | 68.11 |
| IUPAC Name | 1,1,1,2,3,3,3-heptadeuterio-2-deuteriooxypropane |
| SMILES | [2H]OC([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3/i1D3,2D3,3D,4D |
| InChIKey | KFZMGEQAYNKOFK-PIODKIDGSA-N |
| XLogP | 0.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 4 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 68.14 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |