About 1,1,3,3-tetradeuteriourea
1,1,3,3-tetradeuteriourea (PubChem CID 2723980) has the molecular formula CH4N2O
and a molecular weight of 64.08 g/mol. Its IUPAC name is 1,1,3,3-tetradeuteriourea.
Molecular Properties
| Compound Name | 1,1,3,3-tetradeuteriourea |
| PubChem CID | 2723980 |
| Molecular Formula | CH4N2O |
| Molecular Weight | 64.08 g/mol |
| Exact Mass | 64.06 |
| IUPAC Name | 1,1,3,3-tetradeuteriourea |
| SMILES | [2H]N([2H])C(=O)N([2H])[2H] |
| InChI | InChI=1S/CH4N2O/c2-1(3)4/h(H4,2,3,4)/i/hD4 |
| InChIKey | XSQUKJJJFZCRTK-JBISRTOLSA-N |
| XLogP | -0.98 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 64.08 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1,3,3-tetradeuteriourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,3,3-tetradeuteriourea?
The IUPAC name of 1,1,3,3-tetradeuteriourea (CID 2723980) is 1,1,3,3-tetradeuteriourea.
What is the SMILES notation for 1,1,3,3-tetradeuteriourea?
The canonical SMILES for 1,1,3,3-tetradeuteriourea is [2H]N([2H])C(=O)N([2H])[2H].
What is the InChIKey of 1,1,3,3-tetradeuteriourea?
The InChIKey is XSQUKJJJFZCRTK-JBISRTOLSA-N. The full InChI is InChI=1S/CH4N2O/c2-1(3)4/h(H4,2,3,4)/i/hD4.
What are the key properties of 1,1,3,3-tetradeuteriourea?
1,1,3,3-tetradeuteriourea has a molecular weight of 64.08 g/mol, XLogP of -0.98, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,3,3-tetradeuteriourea is sourced from PubChem (CID 2723980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).