About methyl(phenyl)azanium;2,2,2-trifluoroacetate
methyl(phenyl)azanium;2,2,2-trifluoroacetate (PubChem CID 2724109) has the molecular formula C9H10F3NO2
and a molecular weight of 221.18 g/mol. Its IUPAC name is methyl(phenyl)azanium;2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | methyl(phenyl)azanium;2,2,2-trifluoroacetate |
| PubChem CID | 2724109 |
| Molecular Formula | C9H10F3NO2 |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | methyl(phenyl)azanium;2,2,2-trifluoroacetate |
| SMILES | C[NH2+]c1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C7H9N.C2HF3O2/c1-8-7-5-3-2-4-6-7;3-2(4,5)1(6)7/h2-6,8H,1H3;(H,6,7) |
| InChIKey | TXXJGCVOHDSYBC-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl(phenyl)azanium;2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl(phenyl)azanium;2,2,2-trifluoroacetate?
The IUPAC name of methyl(phenyl)azanium;2,2,2-trifluoroacetate (CID 2724109) is methyl(phenyl)azanium;2,2,2-trifluoroacetate.
What is the SMILES notation for methyl(phenyl)azanium;2,2,2-trifluoroacetate?
The canonical SMILES for methyl(phenyl)azanium;2,2,2-trifluoroacetate is C[NH2+]c1ccccc1.O=C([O-])C(F)(F)F.
What is the InChIKey of methyl(phenyl)azanium;2,2,2-trifluoroacetate?
The InChIKey is TXXJGCVOHDSYBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C2HF3O2/c1-8-7-5-3-2-4-6-7;3-2(4,5)1(6)7/h2-6,8H,1H3;(H,6,7).
What are the key properties of methyl(phenyl)azanium;2,2,2-trifluoroacetate?
methyl(phenyl)azanium;2,2,2-trifluoroacetate has a molecular weight of 221.18 g/mol, XLogP of -0.19, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl(phenyl)azanium;2,2,2-trifluoroacetate is sourced from PubChem (CID 2724109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).