About tert-butyl-chloro-dimethylsilane;1H-imidazole
tert-butyl-chloro-dimethylsilane;1H-imidazole (PubChem CID 2724131) has the molecular formula C9H19ClN2Si
and a molecular weight of 218.80 g/mol. Its IUPAC name is tert-butyl-chloro-dimethylsilane;1H-imidazole.
Molecular Properties
| Compound Name | tert-butyl-chloro-dimethylsilane;1H-imidazole |
| PubChem CID | 2724131 |
| Molecular Formula | C9H19ClN2Si |
| Molecular Weight | 218.80 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | tert-butyl-chloro-dimethylsilane;1H-imidazole |
| SMILES | CC(C)(C)[Si](C)(C)Cl.c1c[nH]cn1 |
| InChI | InChI=1S/C6H15ClSi.C3H4N2/c1-6(2,3)8(4,5)7;1-2-5-3-4-1/h1-5H3;1-3H,(H,4,5) |
| InChIKey | IFLPAOFWVBWJPG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.80 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-chloro-dimethylsilane;1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-chloro-dimethylsilane;1H-imidazole?
The IUPAC name of tert-butyl-chloro-dimethylsilane;1H-imidazole (CID 2724131) is tert-butyl-chloro-dimethylsilane;1H-imidazole.
What is the SMILES notation for tert-butyl-chloro-dimethylsilane;1H-imidazole?
The canonical SMILES for tert-butyl-chloro-dimethylsilane;1H-imidazole is CC(C)(C)[Si](C)(C)Cl.c1c[nH]cn1.
What is the InChIKey of tert-butyl-chloro-dimethylsilane;1H-imidazole?
The InChIKey is IFLPAOFWVBWJPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15ClSi.C3H4N2/c1-6(2,3)8(4,5)7;1-2-5-3-4-1/h1-5H3;1-3H,(H,4,5).
What are the key properties of tert-butyl-chloro-dimethylsilane;1H-imidazole?
tert-butyl-chloro-dimethylsilane;1H-imidazole has a molecular weight of 218.80 g/mol, XLogP of 3.64, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-chloro-dimethylsilane;1H-imidazole is sourced from PubChem (CID 2724131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).