About 2-(1,3-dioxan-2-yl)ethyl-triphenylphosphanium
2-(1,3-dioxan-2-yl)ethyl-triphenylphosphanium (PubChem CID 2724169) has the molecular formula C24H26O2P+
and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-(1,3-dioxan-2-yl)ethyl-triphenylphosphanium.
Molecular Properties
| Compound Name | 2-(1,3-dioxan-2-yl)ethyl-triphenylphosphanium |
| PubChem CID | 2724169 |
| Molecular Formula | C24H26O2P+ |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-(1,3-dioxan-2-yl)ethyl-triphenylphosphanium |
| SMILES | c1ccc([P+](CCC2OCCCO2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H26O2P/c1-4-11-21(12-5-1)27(22-13-6-2-7-14-22,23-15-8-3-9-16-23)20-17-24-25-18-10-19-26-24/h1-9,11-16,24H,10,17-20H2/q+1 |
| InChIKey | MQHXAEFTZWVNDN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxan-2-yl)ethyl-triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxan-2-yl)ethyl-triphenylphosphanium?
The IUPAC name of 2-(1,3-dioxan-2-yl)ethyl-triphenylphosphanium (CID 2724169) is 2-(1,3-dioxan-2-yl)ethyl-triphenylphosphanium.
What is the SMILES notation for 2-(1,3-dioxan-2-yl)ethyl-triphenylphosphanium?
The canonical SMILES for 2-(1,3-dioxan-2-yl)ethyl-triphenylphosphanium is c1ccc([P+](CCC2OCCCO2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-(1,3-dioxan-2-yl)ethyl-triphenylphosphanium?
The InChIKey is MQHXAEFTZWVNDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26O2P/c1-4-11-21(12-5-1)27(22-13-6-2-7-14-22,23-15-8-3-9-16-23)20-17-24-25-18-10-19-26-24/h1-9,11-16,24H,10,17-20H2/q+1.
What are the key properties of 2-(1,3-dioxan-2-yl)ethyl-triphenylphosphanium?
2-(1,3-dioxan-2-yl)ethyl-triphenylphosphanium has a molecular weight of 377.44 g/mol, XLogP of 4.13, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxan-2-yl)ethyl-triphenylphosphanium is sourced from PubChem (CID 2724169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).