About 1H-perimidin-2-amine;hydrobromide
1H-perimidin-2-amine;hydrobromide (PubChem CID 2724235) has the molecular formula C11H10BrN3
and a molecular weight of 264.13 g/mol. Its IUPAC name is 1H-perimidin-2-amine;hydrobromide.
Molecular Properties
| Compound Name | 1H-perimidin-2-amine;hydrobromide |
| PubChem CID | 2724235 |
| Molecular Formula | C11H10BrN3 |
| Molecular Weight | 264.13 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 1H-perimidin-2-amine;hydrobromide |
| SMILES | Br.NC1=Nc2cccc3cccc(c23)N1 |
| InChI | InChI=1S/C11H9N3.BrH/c12-11-13-8-5-1-3-7-4-2-6-9(14-11)10(7)8;/h1-6H,(H3,12,13,14);1H |
| InChIKey | HFZUTZWRTHBWPV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.13 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'} |
|---|
Analyze 1H-perimidin-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-perimidin-2-amine;hydrobromide?
The IUPAC name of 1H-perimidin-2-amine;hydrobromide (CID 2724235) is 1H-perimidin-2-amine;hydrobromide.
What is the SMILES notation for 1H-perimidin-2-amine;hydrobromide?
The canonical SMILES for 1H-perimidin-2-amine;hydrobromide is Br.NC1=Nc2cccc3cccc(c23)N1.
What is the InChIKey of 1H-perimidin-2-amine;hydrobromide?
The InChIKey is HFZUTZWRTHBWPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3.BrH/c12-11-13-8-5-1-3-7-4-2-6-9(14-11)10(7)8;/h1-6H,(H3,12,13,14);1H.
What are the key properties of 1H-perimidin-2-amine;hydrobromide?
1H-perimidin-2-amine;hydrobromide has a molecular weight of 264.13 g/mol, XLogP of 2.79, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-perimidin-2-amine;hydrobromide is sourced from PubChem (CID 2724235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).