About lithium 3-oxobutanoate
lithium 3-oxobutanoate (PubChem CID 2724246) has the molecular formula C4H5LiO3
and a molecular weight of 108.02 g/mol. Its IUPAC name is lithium 3-oxobutanoate.
Molecular Properties
| Compound Name | lithium 3-oxobutanoate |
| PubChem CID | 2724246 |
| Molecular Formula | C4H5LiO3 |
| Molecular Weight | 108.02 g/mol |
| Exact Mass | 108.04 |
| IUPAC Name | lithium 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)[O-].[Li+] |
| InChI | InChI=1S/C4H6O3.Li/c1-3(5)2-4(6)7;/h2H2,1H3,(H,6,7);/q;+1/p-1 |
| InChIKey | UTLRZTUJSMCBHB-UHFFFAOYSA-M |
| XLogP | -4.28 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.02 |
| LogP ≤ 5 | -4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze lithium 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 3-oxobutanoate?
The IUPAC name of lithium 3-oxobutanoate (CID 2724246) is lithium 3-oxobutanoate.
What is the SMILES notation for lithium 3-oxobutanoate?
The canonical SMILES for lithium 3-oxobutanoate is CC(=O)CC(=O)[O-].[Li+].
What is the InChIKey of lithium 3-oxobutanoate?
The InChIKey is UTLRZTUJSMCBHB-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6O3.Li/c1-3(5)2-4(6)7;/h2H2,1H3,(H,6,7);/q;+1/p-1.
What are the key properties of lithium 3-oxobutanoate?
lithium 3-oxobutanoate has a molecular weight of 108.02 g/mol, XLogP of -4.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 3-oxobutanoate is sourced from PubChem (CID 2724246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).