About ethyl ethanimidate;hydrochloride
ethyl ethanimidate;hydrochloride (PubChem CID 2724290) has the molecular formula C4H10ClNO
and a molecular weight of 123.58 g/mol. Its IUPAC name is ethyl ethanimidate;hydrochloride.
Molecular Properties
| Compound Name | ethyl ethanimidate;hydrochloride |
| PubChem CID | 2724290 |
| Molecular Formula | C4H10ClNO |
| Molecular Weight | 123.58 g/mol |
| Exact Mass | 123.05 |
| IUPAC Name | ethyl ethanimidate;hydrochloride |
| SMILES | Cl.[H]/N=C(\C)OCC |
| InChI | InChI=1S/C4H9NO.ClH/c1-3-6-4(2)5;/h5H,3H2,1-2H3;1H/b5-4+; |
| InChIKey | WGMHMVLZFAJNOT-FXRZFVDSSA-N |
| XLogP | 1.44 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.58 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl ethanimidate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl ethanimidate;hydrochloride?
The IUPAC name of ethyl ethanimidate;hydrochloride (CID 2724290) is ethyl ethanimidate;hydrochloride.
What is the SMILES notation for ethyl ethanimidate;hydrochloride?
The canonical SMILES for ethyl ethanimidate;hydrochloride is Cl.[H]/N=C(\C)OCC.
What is the InChIKey of ethyl ethanimidate;hydrochloride?
The InChIKey is WGMHMVLZFAJNOT-FXRZFVDSSA-N. The full InChI is InChI=1S/C4H9NO.ClH/c1-3-6-4(2)5;/h5H,3H2,1-2H3;1H/b5-4+;.
What are the key properties of ethyl ethanimidate;hydrochloride?
ethyl ethanimidate;hydrochloride has a molecular weight of 123.58 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl ethanimidate;hydrochloride is sourced from PubChem (CID 2724290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).